C18H16BrNO2 — CID 170463568
benzyl N-[4-(4-bromophenyl)but-3-ynyl]carbamate (PubChem CID 170463568) has the molecular formula C18H16BrNO2 and a molecular weight of 358.24 g/mol. Its IUPAC name is benzyl N-[4-(4-bromophenyl)but-3-ynyl]carbamate.
| Compound Name | benzyl N-[4-(4-bromophenyl)but-3-ynyl]carbamate |
|---|---|
| PubChem CID | 170463568 |
| Molecular Formula | C18H16BrNO2 |
| Molecular Weight | 358.24 g/mol |
| Exact Mass | 357.04 |
| IUPAC Name | benzyl N-[4-(4-bromophenyl)but-3-ynyl]carbamate |
| SMILES | O=C(NCCC#Cc1ccc(Br)cc1)OCc1ccccc1 |
| InChI | InChI=1S/C18H16BrNO2/c19-17-11-9-15(10-12-17)6-4-5-13-20-18(21)22-14-16-7-2-1-3-8-16/h1-3,7-12H,5,13-14H2,(H,20,21) |
| InChIKey | TWBVPZJZRLLFPO-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.24 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|