C18H19N3O2 — CID 170462198
benzyl N-[4-(4-hydrazinylphenyl)but-3-ynyl]carbamate (PubChem CID 170462198) has the molecular formula C18H19N3O2 and a molecular weight of 309.37 g/mol. Its IUPAC name is benzyl N-[4-(4-hydrazinylphenyl)but-3-ynyl]carbamate.
| Compound Name | benzyl N-[4-(4-hydrazinylphenyl)but-3-ynyl]carbamate |
|---|---|
| PubChem CID | 170462198 |
| Molecular Formula | C18H19N3O2 |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.15 |
| IUPAC Name | benzyl N-[4-(4-hydrazinylphenyl)but-3-ynyl]carbamate |
| SMILES | NNc1ccc(C#CCCNC(=O)OCc2ccccc2)cc1 |
| InChI | InChI=1S/C18H19N3O2/c19-21-17-11-9-15(10-12-17)6-4-5-13-20-18(22)23-14-16-7-2-1-3-8-16/h1-3,7-12,21H,5,13-14,19H2,(H,20,22) |
| InChIKey | OXUDXISWKJFDGC-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|