C26H31N3O5 — CID 58664814
benzyl N-[4-[4-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoylamino]phenyl]but-3-ynyl]carbamate (PubChem CID 58664814) has the molecular formula C26H31N3O5 and a molecular weight of 465.55 g/mol. Its IUPAC name is benzyl N-[4-[4-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoylamino]phenyl]but-3-ynyl]carbamate.
| Compound Name | benzyl N-[4-[4-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoylamino]phenyl]but-3-ynyl]carbamate |
|---|---|
| PubChem CID | 58664814 |
| Molecular Formula | C26H31N3O5 |
| Molecular Weight | 465.55 g/mol |
| Exact Mass | 465.23 |
| IUPAC Name | benzyl N-[4-[4-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoylamino]phenyl]but-3-ynyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCC(=O)Nc1ccc(C#CCCNC(=O)OCc2ccccc2)cc1 |
| InChI | InChI=1S/C26H31N3O5/c1-26(2,3)34-25(32)28-18-16-23(30)29-22-14-12-20(13-15-22)9-7-8-17-27-24(31)33-19-21-10-5-4-6-11-21/h4-6,10-15H,8,16-19H2,1-3H3,(H,27,31)(H,28,32)(H,29,30) |
| InChIKey | ILHZMVOQCQNXTD-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 105.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.55 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|