C30H32N2O6 — CID 90228500
(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-[6-[4-(phenylmethoxycarbonylamino)but-1-ynyl]naphthalen-2-yl]propanoic acid (PubChem CID 90228500) has the molecular formula C30H32N2O6 and a molecular weight of 516.59 g/mol. Its IUPAC name is (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-[6-[4-(phenylmethoxycarbonylamino)but-1-ynyl]naphthalen-2-yl]propanoic acid.
| Compound Name | (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-[6-[4-(phenylmethoxycarbonylamino)but-1-ynyl]naphthalen-2-yl]propanoic acid |
|---|---|
| PubChem CID | 90228500 |
| Molecular Formula | C30H32N2O6 |
| Molecular Weight | 516.59 g/mol |
| Exact Mass | 516.23 |
| IUPAC Name | (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-[6-[4-(phenylmethoxycarbonylamino)but-1-ynyl]naphthalen-2-yl]propanoic acid |
| SMILES | CC(C)(C)OC(=O)N[C@@H](Cc1ccc2cc(C#CCCNC(=O)OCc3ccccc3)ccc2c1)C(=O)O |
| InChI | InChI=1S/C30H32N2O6/c1-30(2,3)38-29(36)32-26(27(33)34)19-23-13-15-24-17-21(12-14-25(24)18-23)9-7-8-16-31-28(35)37-20-22-10-5-4-6-11-22/h4-6,10-15,17-18,26H,8,16,19-20H2,1-3H3,(H,31,35)(H,32,36)(H,33,34)/t26-/m0/s1 |
| InChIKey | ITFLILKGCJKBKX-SANMLTNESA-N |
| XLogP | 5.03 |
| TPSA | 113.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.59 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|