C31H34N4O8 — CID 156754578
(2S)-3-[3-[bis(phenylmethoxycarbonylamino)methylideneamino]phenyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (PubChem CID 156754578) has the molecular formula C31H34N4O8 and a molecular weight of 590.63 g/mol. Its IUPAC name is (2S)-3-[3-[bis(phenylmethoxycarbonylamino)methylideneamino]phenyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid.
| Compound Name | (2S)-3-[3-[bis(phenylmethoxycarbonylamino)methylideneamino]phenyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
|---|---|
| PubChem CID | 156754578 |
| Molecular Formula | C31H34N4O8 |
| Molecular Weight | 590.63 g/mol |
| Exact Mass | 590.24 |
| IUPAC Name | (2S)-3-[3-[bis(phenylmethoxycarbonylamino)methylideneamino]phenyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| SMILES | CC(C)(C)OC(=O)N[C@@H](Cc1cccc(N=C(NC(=O)OCc2ccccc2)NC(=O)OCc2ccccc2)c1)C(=O)O |
| InChI | InChI=1S/C31H34N4O8/c1-31(2,3)43-30(40)33-25(26(36)37)18-23-15-10-16-24(17-23)32-27(34-28(38)41-19-21-11-6-4-7-12-21)35-29(39)42-20-22-13-8-5-9-14-22/h4-17,25H,18-20H2,1-3H3,(H,33,40)(H,36,37)(H2,32,34,35,38,39)/t25-/m0/s1 |
| InChIKey | YALFDUXFBJQMPK-VWLOTQADSA-N |
| XLogP | 5.05 |
| TPSA | 164.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.63 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|