C26H40N4O8 — CID 135872766
(2R)-3-[3-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]phenyl]-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]propanoic acid (PubChem CID 135872766) has the molecular formula C26H40N4O8 and a molecular weight of 536.63 g/mol. Its IUPAC name is (2R)-3-[3-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]phenyl]-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]propanoic acid.
| Compound Name | (2R)-3-[3-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]phenyl]-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]propanoic acid |
|---|---|
| PubChem CID | 135872766 |
| Molecular Formula | C26H40N4O8 |
| Molecular Weight | 536.63 g/mol |
| Exact Mass | 536.28 |
| IUPAC Name | (2R)-3-[3-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]phenyl]-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]propanoic acid |
| SMILES | CN(C(=O)OC(C)(C)C)[C@H](Cc1cccc(N=C(NC(=O)OC(C)(C)C)NC(=O)OC(C)(C)C)c1)C(=O)O |
| InChI | InChI=1S/C26H40N4O8/c1-24(2,3)36-21(33)28-20(29-22(34)37-25(4,5)6)27-17-13-11-12-16(14-17)15-18(19(31)32)30(10)23(35)38-26(7,8)9/h11-14,18H,15H2,1-10H3,(H,31,32)(H2,27,28,29,33,34)/t18-/m1/s1 |
| InChIKey | UXYMPQLHPBTBPV-GOSISDBHSA-N |
| XLogP | 4.59 |
| TPSA | 155.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.63 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|