C15H20INO4 — CID 22327028
3-(4-iodophenyl)-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]propanoic acid (PubChem CID 22327028) has the molecular formula C15H20INO4 and a molecular weight of 405.23 g/mol. Its IUPAC name is 3-(4-iodophenyl)-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]propanoic acid.
| Compound Name | 3-(4-iodophenyl)-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]propanoic acid |
|---|---|
| PubChem CID | 22327028 |
| Molecular Formula | C15H20INO4 |
| Molecular Weight | 405.23 g/mol |
| Exact Mass | 405.04 |
| IUPAC Name | 3-(4-iodophenyl)-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]propanoic acid |
| SMILES | CN(C(=O)OC(C)(C)C)C(Cc1ccc(I)cc1)C(=O)O |
| InChI | InChI=1S/C15H20INO4/c1-15(2,3)21-14(20)17(4)12(13(18)19)9-10-5-7-11(16)8-6-10/h5-8,12H,9H2,1-4H3,(H,18,19) |
| InChIKey | OYXXJRHZHGHHJG-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.23 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|