C19H27NO7 — CID 54499711
(2S)-2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-(4-hydroxyphenyl)propanoic acid (PubChem CID 54499711) has the molecular formula C19H27NO7 and a molecular weight of 381.43 g/mol. Its IUPAC name is (2S)-2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-(4-hydroxyphenyl)propanoic acid.
| Compound Name | (2S)-2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-(4-hydroxyphenyl)propanoic acid |
|---|---|
| PubChem CID | 54499711 |
| Molecular Formula | C19H27NO7 |
| Molecular Weight | 381.43 g/mol |
| Exact Mass | 381.18 |
| IUPAC Name | (2S)-2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-(4-hydroxyphenyl)propanoic acid |
| SMILES | CC(C)(C)OC(=O)N(C(=O)OC(C)(C)C)[C@@H](Cc1ccc(O)cc1)C(=O)O |
| InChI | InChI=1S/C19H27NO7/c1-18(2,3)26-16(24)20(17(25)27-19(4,5)6)14(15(22)23)11-12-7-9-13(21)10-8-12/h7-10,14,21H,11H2,1-6H3,(H,22,23)/t14-/m0/s1 |
| InChIKey | YBOVRDUXJKGVSL-AWEZNQCLSA-N |
| XLogP | 3.56 |
| TPSA | 113.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.43 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |