C18H27NO5 — CID 174758174
2-[butyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-(4-hydroxyphenyl)propanoic acid (PubChem CID 174758174) has the molecular formula C18H27NO5 and a molecular weight of 337.42 g/mol. Its IUPAC name is 2-[butyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-(4-hydroxyphenyl)propanoic acid.
| Compound Name | 2-[butyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-(4-hydroxyphenyl)propanoic acid |
|---|---|
| PubChem CID | 174758174 |
| Molecular Formula | C18H27NO5 |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.19 |
| IUPAC Name | 2-[butyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-(4-hydroxyphenyl)propanoic acid |
| SMILES | CCCCN(C(=O)OC(C)(C)C)C(Cc1ccc(O)cc1)C(=O)O |
| InChI | InChI=1S/C18H27NO5/c1-5-6-11-19(17(23)24-18(2,3)4)15(16(21)22)12-13-7-9-14(20)10-8-13/h7-10,15,20H,5-6,11-12H2,1-4H3,(H,21,22) |
| InChIKey | VJBWFOAWUCZISF-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |