C24H39NO4 — CID 139433016
2-[2-hexyloctanoyl(methyl)amino]-3-(4-hydroxyphenyl)propanoic acid (PubChem CID 139433016) has the molecular formula C24H39NO4 and a molecular weight of 405.58 g/mol. Its IUPAC name is 2-[2-hexyloctanoyl(methyl)amino]-3-(4-hydroxyphenyl)propanoic acid.
| Compound Name | 2-[2-hexyloctanoyl(methyl)amino]-3-(4-hydroxyphenyl)propanoic acid |
|---|---|
| PubChem CID | 139433016 |
| Molecular Formula | C24H39NO4 |
| Molecular Weight | 405.58 g/mol |
| Exact Mass | 405.29 |
| IUPAC Name | 2-[2-hexyloctanoyl(methyl)amino]-3-(4-hydroxyphenyl)propanoic acid |
| SMILES | CCCCCCC(CCCCCC)C(=O)N(C)C(Cc1ccc(O)cc1)C(=O)O |
| InChI | InChI=1S/C24H39NO4/c1-4-6-8-10-12-20(13-11-9-7-5-2)23(27)25(3)22(24(28)29)18-19-14-16-21(26)17-15-19/h14-17,20,22,26H,4-13,18H2,1-3H3,(H,28,29) |
| InChIKey | XMSJMUFIWNUYNK-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.58 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|