C15H21NO4S — CID 71243392
2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-(4-sulfanylphenyl)propanoic acid (PubChem CID 71243392) has the molecular formula C15H21NO4S and a molecular weight of 311.40 g/mol. Its IUPAC name is 2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-(4-sulfanylphenyl)propanoic acid.
| Compound Name | 2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-(4-sulfanylphenyl)propanoic acid |
|---|---|
| PubChem CID | 71243392 |
| Molecular Formula | C15H21NO4S |
| Molecular Weight | 311.40 g/mol |
| Exact Mass | 311.12 |
| IUPAC Name | 2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-(4-sulfanylphenyl)propanoic acid |
| SMILES | CN(C(=O)OC(C)(C)C)C(Cc1ccc(S)cc1)C(=O)O |
| InChI | InChI=1S/C15H21NO4S/c1-15(2,3)20-14(19)16(4)12(13(17)18)9-10-5-7-11(21)8-6-10/h5-8,12,21H,9H2,1-4H3,(H,17,18) |
| InChIKey | FKWIZRGOYSSMAK-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.40 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|