C17H24BrNO5 — CID 67061078
methyl (2S)-2-[1-bromoethyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-(4-hydroxyphenyl)propanoate (PubChem CID 67061078) has the molecular formula C17H24BrNO5 and a molecular weight of 402.29 g/mol. Its IUPAC name is methyl (2S)-2-[1-bromoethyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-(4-hydroxyphenyl)propanoate.
| Compound Name | methyl (2S)-2-[1-bromoethyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-(4-hydroxyphenyl)propanoate |
|---|---|
| PubChem CID | 67061078 |
| Molecular Formula | C17H24BrNO5 |
| Molecular Weight | 402.29 g/mol |
| Exact Mass | 401.08 |
| IUPAC Name | methyl (2S)-2-[1-bromoethyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-(4-hydroxyphenyl)propanoate |
| SMILES | COC(=O)[C@H](Cc1ccc(O)cc1)N(C(=O)OC(C)(C)C)C(C)Br |
| InChI | InChI=1S/C17H24BrNO5/c1-11(18)19(16(22)24-17(2,3)4)14(15(21)23-5)10-12-6-8-13(20)9-7-12/h6-9,11,14,20H,10H2,1-5H3/t11?,14-/m0/s1 |
| InChIKey | QHNXVEMQRSBDID-IAXJKZSUSA-N |
| XLogP | 3.45 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.29 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|