C17H25N3O5 — CID 172954496
methyl 2-[hydroxy-[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-[4-[(E)-(methylhydrazinylidene)methyl]phenyl]propanoate (PubChem CID 172954496) has the molecular formula C17H25N3O5 and a molecular weight of 351.40 g/mol. Its IUPAC name is methyl 2-[hydroxy-[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-[4-[(E)-(methylhydrazinylidene)methyl]phenyl]propanoate.
| Compound Name | methyl 2-[hydroxy-[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-[4-[(E)-(methylhydrazinylidene)methyl]phenyl]propanoate |
|---|---|
| PubChem CID | 172954496 |
| Molecular Formula | C17H25N3O5 |
| Molecular Weight | 351.40 g/mol |
| Exact Mass | 351.18 |
| IUPAC Name | methyl 2-[hydroxy-[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-[4-[(E)-(methylhydrazinylidene)methyl]phenyl]propanoate |
| SMILES | CN/N=C/c1ccc(CC(C(=O)OC)N(O)C(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C17H25N3O5/c1-17(2,3)25-16(22)20(23)14(15(21)24-5)10-12-6-8-13(9-7-12)11-19-18-4/h6-9,11,14,18,23H,10H2,1-5H3/b19-11+ |
| InChIKey | CFIULFPGXWWDGJ-YBFXNURJSA-N |
| XLogP | 1.95 |
| TPSA | 100.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.40 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|