C25H37NO9 — CID 73236163
methyl 2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-[4-[(2-methylpropan-2-yl)oxycarbonyloxy]phenyl]propanoate (PubChem CID 73236163) has the molecular formula C25H37NO9 and a molecular weight of 495.57 g/mol. Its IUPAC name is methyl 2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-[4-[(2-methylpropan-2-yl)oxycarbonyloxy]phenyl]propanoate.
| Compound Name | methyl 2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-[4-[(2-methylpropan-2-yl)oxycarbonyloxy]phenyl]propanoate |
|---|---|
| PubChem CID | 73236163 |
| Molecular Formula | C25H37NO9 |
| Molecular Weight | 495.57 g/mol |
| Exact Mass | 495.25 |
| IUPAC Name | methyl 2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-[4-[(2-methylpropan-2-yl)oxycarbonyloxy]phenyl]propanoate |
| SMILES | COC(=O)C(Cc1ccc(OC(=O)OC(C)(C)C)cc1)N(C(=O)OC(C)(C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C25H37NO9/c1-23(2,3)33-20(28)26(21(29)34-24(4,5)6)18(19(27)31-10)15-16-11-13-17(14-12-16)32-22(30)35-25(7,8)9/h11-14,18H,15H2,1-10H3 |
| InChIKey | PXIGTFYYTBOFNT-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 117.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.57 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|