C28H42FNO9 — CID 129087280
tert-butyl (2R)-2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-[2-(18F)fluoro-5-[(2-methylpropan-2-yl)oxycarbonyloxy]phenyl]propanoate (PubChem CID 129087280) has the molecular formula C28H42FNO9 and a molecular weight of 554.64 g/mol. Its IUPAC name is tert-butyl (2R)-2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-[2-(18F)fluoro-5-[(2-methylpropan-2-yl)oxycarbonyloxy]phenyl]propanoate.
| Compound Name | tert-butyl (2R)-2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-[2-(18F)fluoro-5-[(2-methylpropan-2-yl)oxycarbonyloxy]phenyl]propanoate |
|---|---|
| PubChem CID | 129087280 |
| Molecular Formula | C28H42FNO9 |
| Molecular Weight | 554.64 g/mol |
| Exact Mass | 554.29 |
| IUPAC Name | tert-butyl (2R)-2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-[2-(18F)fluoro-5-[(2-methylpropan-2-yl)oxycarbonyloxy]phenyl]propanoate |
| SMILES | CC(C)(C)OC(=O)Oc1ccc([18F])c(C[C@H](C(=O)OC(C)(C)C)N(C(=O)OC(C)(C)C)C(=O)OC(C)(C)C)c1 |
| InChI | InChI=1S/C28H42FNO9/c1-25(2,3)36-21(31)20(30(22(32)37-26(4,5)6)23(33)38-27(7,8)9)16-17-15-18(13-14-19(17)29)35-24(34)39-28(10,11)12/h13-15,20H,16H2,1-12H3/t20-/m1/s1/i29-1 |
| InChIKey | YEYGFGWFJLMKEW-JGHLBBROSA-N |
| XLogP | 6.56 |
| TPSA | 117.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.64 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|