C19H34INO6 — CID 134884144
tert-butyl (2S)-2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-5-iodopentanoate (PubChem CID 134884144) has the molecular formula C19H34INO6 and a molecular weight of 499.39 g/mol. Its IUPAC name is tert-butyl (2S)-2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-5-iodopentanoate.
| Compound Name | tert-butyl (2S)-2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-5-iodopentanoate |
|---|---|
| PubChem CID | 134884144 |
| Molecular Formula | C19H34INO6 |
| Molecular Weight | 499.39 g/mol |
| Exact Mass | 499.14 |
| IUPAC Name | tert-butyl (2S)-2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-5-iodopentanoate |
| SMILES | CC(C)(C)OC(=O)[C@H](CCCI)N(C(=O)OC(C)(C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C19H34INO6/c1-17(2,3)25-14(22)13(11-10-12-20)21(15(23)26-18(4,5)6)16(24)27-19(7,8)9/h13H,10-12H2,1-9H3/t13-/m0/s1 |
| InChIKey | GULLPGMOWZLGSB-ZDUSSCGKSA-N |
| XLogP | 5.08 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.39 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|