C21H39NO7 — CID 101425111
tert-butyl (2S,4S)-2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-6-hydroxy-4-methylhexanoate (PubChem CID 101425111) has the molecular formula C21H39NO7 and a molecular weight of 417.54 g/mol. Its IUPAC name is tert-butyl (2S,4S)-2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-6-hydroxy-4-methylhexanoate.
| Compound Name | tert-butyl (2S,4S)-2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-6-hydroxy-4-methylhexanoate |
|---|---|
| PubChem CID | 101425111 |
| Molecular Formula | C21H39NO7 |
| Molecular Weight | 417.54 g/mol |
| Exact Mass | 417.27 |
| IUPAC Name | tert-butyl (2S,4S)-2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-6-hydroxy-4-methylhexanoate |
| SMILES | C[C@H](CCO)C[C@@H](C(=O)OC(C)(C)C)N(C(=O)OC(C)(C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C21H39NO7/c1-14(11-12-23)13-15(16(24)27-19(2,3)4)22(17(25)28-20(5,6)7)18(26)29-21(8,9)10/h14-15,23H,11-13H2,1-10H3/t14-,15+/m1/s1 |
| InChIKey | WZPDMEQNKPYIMF-CABCVRRESA-N |
| XLogP | 4.28 |
| TPSA | 102.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.54 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|