C24H47NO7Si — CID 89148378
tert-butyl (2S)-7-[hydroxy(dimethyl)silyl]-7-methyl-2-[(2-methylpropan-2-yl)oxycarbonyl-propan-2-yloxycarbonylamino]octanoate (PubChem CID 89148378) has the molecular formula C24H47NO7Si and a molecular weight of 489.73 g/mol. Its IUPAC name is tert-butyl (2S)-7-[hydroxy(dimethyl)silyl]-7-methyl-2-[(2-methylpropan-2-yl)oxycarbonyl-propan-2-yloxycarbonylamino]octanoate.
| Compound Name | tert-butyl (2S)-7-[hydroxy(dimethyl)silyl]-7-methyl-2-[(2-methylpropan-2-yl)oxycarbonyl-propan-2-yloxycarbonylamino]octanoate |
|---|---|
| PubChem CID | 89148378 |
| Molecular Formula | C24H47NO7Si |
| Molecular Weight | 489.73 g/mol |
| Exact Mass | 489.31 |
| IUPAC Name | tert-butyl (2S)-7-[hydroxy(dimethyl)silyl]-7-methyl-2-[(2-methylpropan-2-yl)oxycarbonyl-propan-2-yloxycarbonylamino]octanoate |
| SMILES | CC(C)OC(=O)N(C(=O)OC(C)(C)C)[C@@H](CCCCC(C)(C)[Si](C)(C)O)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C24H47NO7Si/c1-17(2)30-20(27)25(21(28)32-23(6,7)8)18(19(26)31-22(3,4)5)15-13-14-16-24(9,10)33(11,12)29/h17-18,29H,13-16H2,1-12H3/t18-/m0/s1 |
| InChIKey | NSHHGVXWBZEBBB-SFHVURJKSA-N |
| XLogP | 6.02 |
| TPSA | 102.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.73 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|