C24H43NO11S — CID 101202395
7-O-tert-butyl 1-O-ethyl (2S,6S)-6-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-2-methylsulfonyloxyheptanedioate (PubChem CID 101202395) has the molecular formula C24H43NO11S and a molecular weight of 553.67 g/mol. Its IUPAC name is 7-O-tert-butyl 1-O-ethyl (2S,6S)-6-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-2-methylsulfonyloxyheptanedioate.
| Compound Name | 7-O-tert-butyl 1-O-ethyl (2S,6S)-6-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-2-methylsulfonyloxyheptanedioate |
|---|---|
| PubChem CID | 101202395 |
| Molecular Formula | C24H43NO11S |
| Molecular Weight | 553.67 g/mol |
| Exact Mass | 553.26 |
| IUPAC Name | 7-O-tert-butyl 1-O-ethyl (2S,6S)-6-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-2-methylsulfonyloxyheptanedioate |
| SMILES | CCOC(=O)[C@H](CCC[C@@H](C(=O)OC(C)(C)C)N(C(=O)OC(C)(C)C)C(=O)OC(C)(C)C)OS(C)(=O)=O |
| InChI | InChI=1S/C24H43NO11S/c1-12-32-19(27)17(36-37(11,30)31)15-13-14-16(18(26)33-22(2,3)4)25(20(28)34-23(5,6)7)21(29)35-24(8,9)10/h16-17H,12-15H2,1-11H3/t16-,17-/m0/s1 |
| InChIKey | KZDRWOCSHWNABI-IRXDYDNUSA-N |
| XLogP | 3.95 |
| TPSA | 151.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.67 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|