C23H40N4O8 — CID 11271997
7-O-tert-butyl 1-O-ethyl (2R,6S)-2-azido-6-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]heptanedioate (PubChem CID 11271997) has the molecular formula C23H40N4O8 and a molecular weight of 500.59 g/mol. Its IUPAC name is 7-O-tert-butyl 1-O-ethyl (2R,6S)-2-azido-6-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]heptanedioate.
| Compound Name | 7-O-tert-butyl 1-O-ethyl (2R,6S)-2-azido-6-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]heptanedioate |
|---|---|
| PubChem CID | 11271997 |
| Molecular Formula | C23H40N4O8 |
| Molecular Weight | 500.59 g/mol |
| Exact Mass | 500.28 |
| IUPAC Name | 7-O-tert-butyl 1-O-ethyl (2R,6S)-2-azido-6-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]heptanedioate |
| SMILES | CCOC(=O)[C@@H](CCC[C@@H](C(=O)OC(C)(C)C)N(C(=O)OC(C)(C)C)C(=O)OC(C)(C)C)N=[N+]=[N-] |
| InChI | InChI=1S/C23H40N4O8/c1-11-32-17(28)15(25-26-24)13-12-14-16(18(29)33-21(2,3)4)27(19(30)34-22(5,6)7)20(31)35-23(8,9)10/h15-16H,11-14H2,1-10H3/t15-,16+/m1/s1 |
| InChIKey | DYIUXOOKSLXPJA-CVEARBPZSA-N |
| XLogP | 5.28 |
| TPSA | 157.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.59 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|