C23H40N2O7 — CID 170188445
tert-butyl (E)-2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-7-(dimethylamino)-7-oxohept-5-enoate (PubChem CID 170188445) has the molecular formula C23H40N2O7 and a molecular weight of 456.58 g/mol. Its IUPAC name is tert-butyl (E)-2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-7-(dimethylamino)-7-oxohept-5-enoate.
| Compound Name | tert-butyl (E)-2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-7-(dimethylamino)-7-oxohept-5-enoate |
|---|---|
| PubChem CID | 170188445 |
| Molecular Formula | C23H40N2O7 |
| Molecular Weight | 456.58 g/mol |
| Exact Mass | 456.28 |
| IUPAC Name | tert-butyl (E)-2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-7-(dimethylamino)-7-oxohept-5-enoate |
| SMILES | CN(C)C(=O)/C=C/CCC(C(=O)OC(C)(C)C)N(C(=O)OC(C)(C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C23H40N2O7/c1-21(2,3)30-18(27)16(14-12-13-15-17(26)24(10)11)25(19(28)31-22(4,5)6)20(29)32-23(7,8)9/h13,15-16H,12,14H2,1-11H3/b15-13+ |
| InChIKey | KXNKKGNSNMEXAG-FYWRMAATSA-N |
| XLogP | 4.29 |
| TPSA | 102.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.58 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|