C30H48Cl3NO11 — CID 101202392
ditert-butyl (E,6S)-6-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-2-(1,1,1-trichloro-2-methylpropan-2-yl)oxycarbonyloxyhept-2-enedioate (PubChem CID 101202392) has the molecular formula C30H48Cl3NO11 and a molecular weight of 705.07 g/mol. Its IUPAC name is ditert-butyl (E,6S)-6-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-2-(1,1,1-trichloro-2-methylpropan-2-yl)oxycarbonyloxyhept-2-enedioate.
| Compound Name | ditert-butyl (E,6S)-6-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-2-(1,1,1-trichloro-2-methylpropan-2-yl)oxycarbonyloxyhept-2-enedioate |
|---|---|
| PubChem CID | 101202392 |
| Molecular Formula | C30H48Cl3NO11 |
| Molecular Weight | 705.07 g/mol |
| Exact Mass | 703.23 |
| IUPAC Name | ditert-butyl (E,6S)-6-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-2-(1,1,1-trichloro-2-methylpropan-2-yl)oxycarbonyloxyhept-2-enedioate |
| SMILES | CC(C)(C)OC(=O)/C(=C\CC[C@@H](C(=O)OC(C)(C)C)N(C(=O)OC(C)(C)C)C(=O)OC(C)(C)C)OC(=O)OC(C)(C)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C30H48Cl3NO11/c1-25(2,3)41-20(35)18(34(22(37)43-27(7,8)9)23(38)44-28(10,11)12)16-15-17-19(21(36)42-26(4,5)6)40-24(39)45-29(13,14)30(31,32)33/h17-18H,15-16H2,1-14H3/b19-17+/t18-/m0/s1 |
| InChIKey | DDRDDCSLTOQJMI-GHNGSUTGSA-N |
| XLogP | 8.18 |
| TPSA | 143.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 705.07 |
| LogP ≤ 5 | 8.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|