C22H31NO7 — CID 58890811
benzyl (2R)-2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-5-oxopentanoate (PubChem CID 58890811) has the molecular formula C22H31NO7 and a molecular weight of 421.49 g/mol. Its IUPAC name is benzyl (2R)-2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-5-oxopentanoate.
| Compound Name | benzyl (2R)-2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-5-oxopentanoate |
|---|---|
| PubChem CID | 58890811 |
| Molecular Formula | C22H31NO7 |
| Molecular Weight | 421.49 g/mol |
| Exact Mass | 421.21 |
| IUPAC Name | benzyl (2R)-2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-5-oxopentanoate |
| SMILES | CC(C)(C)OC(=O)N(C(=O)OC(C)(C)C)[C@H](CCC=O)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C22H31NO7/c1-21(2,3)29-19(26)23(20(27)30-22(4,5)6)17(13-10-14-24)18(25)28-15-16-11-8-7-9-12-16/h7-9,11-12,14,17H,10,13,15H2,1-6H3/t17-/m1/s1 |
| InChIKey | MTIFZHHXZBCEMJ-QGZVFWFLSA-N |
| XLogP | 4.25 |
| TPSA | 99.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.49 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|