C28H35NO6 — CID 22956972
tert-butyl 3-[[benzyl(phenylmethoxycarbonyl)amino]methyl]-4-oxo-2-(3-oxopropyl)pentanoate (PubChem CID 22956972) has the molecular formula C28H35NO6 and a molecular weight of 481.59 g/mol. Its IUPAC name is tert-butyl 3-[[benzyl(phenylmethoxycarbonyl)amino]methyl]-4-oxo-2-(3-oxopropyl)pentanoate.
| Compound Name | tert-butyl 3-[[benzyl(phenylmethoxycarbonyl)amino]methyl]-4-oxo-2-(3-oxopropyl)pentanoate |
|---|---|
| PubChem CID | 22956972 |
| Molecular Formula | C28H35NO6 |
| Molecular Weight | 481.59 g/mol |
| Exact Mass | 481.25 |
| IUPAC Name | tert-butyl 3-[[benzyl(phenylmethoxycarbonyl)amino]methyl]-4-oxo-2-(3-oxopropyl)pentanoate |
| SMILES | CC(=O)C(CN(Cc1ccccc1)C(=O)OCc1ccccc1)C(CCC=O)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C28H35NO6/c1-21(31)25(24(16-11-17-30)26(32)35-28(2,3)4)19-29(18-22-12-7-5-8-13-22)27(33)34-20-23-14-9-6-10-15-23/h5-10,12-15,17,24-25H,11,16,18-20H2,1-4H3 |
| InChIKey | OJSVSDOTNJCNLP-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.59 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|