C35H43NO7 — CID 91150716
4-O-benzyl 1-O-tert-butyl (2S)-3-[[benzyl(phenylmethoxycarbonyl)amino]methyl]-2-(2-oxoethyl)butanedioate;ethane (PubChem CID 91150716) has the molecular formula C35H43NO7 and a molecular weight of 589.73 g/mol. Its IUPAC name is 4-O-benzyl 1-O-tert-butyl (2S)-3-[[benzyl(phenylmethoxycarbonyl)amino]methyl]-2-(2-oxoethyl)butanedioate;ethane.
| Compound Name | 4-O-benzyl 1-O-tert-butyl (2S)-3-[[benzyl(phenylmethoxycarbonyl)amino]methyl]-2-(2-oxoethyl)butanedioate;ethane |
|---|---|
| PubChem CID | 91150716 |
| Molecular Formula | C35H43NO7 |
| Molecular Weight | 589.73 g/mol |
| Exact Mass | 589.30 |
| IUPAC Name | 4-O-benzyl 1-O-tert-butyl (2S)-3-[[benzyl(phenylmethoxycarbonyl)amino]methyl]-2-(2-oxoethyl)butanedioate;ethane |
| SMILES | CC.CC(C)(C)OC(=O)[C@@H](CC=O)C(CN(Cc1ccccc1)C(=O)OCc1ccccc1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C33H37NO7.C2H6/c1-33(2,3)41-31(37)28(19-20-35)29(30(36)39-23-26-15-9-5-10-16-26)22-34(21-25-13-7-4-8-14-25)32(38)40-24-27-17-11-6-12-18-27;1-2/h4-18,20,28-29H,19,21-24H2,1-3H3;1-2H3/t28-,29?;/m0./s1 |
| InChIKey | OVVQLWKTHMKUHE-MKSHZDIXSA-N |
| XLogP | 6.76 |
| TPSA | 99.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.73 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|