C17H25NO3 — CID 171078650
benzyl N-(2,2-dimethyl-6-oxohexyl)-N-methylcarbamate (PubChem CID 171078650) has the molecular formula C17H25NO3 and a molecular weight of 291.39 g/mol. Its IUPAC name is benzyl N-(2,2-dimethyl-6-oxohexyl)-N-methylcarbamate.
| Compound Name | benzyl N-(2,2-dimethyl-6-oxohexyl)-N-methylcarbamate |
|---|---|
| PubChem CID | 171078650 |
| Molecular Formula | C17H25NO3 |
| Molecular Weight | 291.39 g/mol |
| Exact Mass | 291.18 |
| IUPAC Name | benzyl N-(2,2-dimethyl-6-oxohexyl)-N-methylcarbamate |
| SMILES | CN(CC(C)(C)CCCC=O)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C17H25NO3/c1-17(2,11-7-8-12-19)14-18(3)16(20)21-13-15-9-5-4-6-10-15/h4-6,9-10,12H,7-8,11,13-14H2,1-3H3 |
| InChIKey | YNXYRIZGNOKKRM-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.39 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|