C23H29Br2NO2 — CID 171078217
benzyl N-[6-bromo-6-(3-bromophenyl)-2,2-dimethylhexyl]-N-methylcarbamate (PubChem CID 171078217) has the molecular formula C23H29Br2NO2 and a molecular weight of 511.30 g/mol. Its IUPAC name is benzyl N-[6-bromo-6-(3-bromophenyl)-2,2-dimethylhexyl]-N-methylcarbamate.
| Compound Name | benzyl N-[6-bromo-6-(3-bromophenyl)-2,2-dimethylhexyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 171078217 |
| Molecular Formula | C23H29Br2NO2 |
| Molecular Weight | 511.30 g/mol |
| Exact Mass | 509.06 |
| IUPAC Name | benzyl N-[6-bromo-6-(3-bromophenyl)-2,2-dimethylhexyl]-N-methylcarbamate |
| SMILES | CN(CC(C)(C)CCCC(Br)c1cccc(Br)c1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C23H29Br2NO2/c1-23(2,14-8-13-21(25)19-11-7-12-20(24)15-19)17-26(3)22(27)28-16-18-9-5-4-6-10-18/h4-7,9-12,15,21H,8,13-14,16-17H2,1-3H3 |
| InChIKey | MNIDBHVFWIMWGC-UHFFFAOYSA-N |
| XLogP | 7.35 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.30 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|