C14H21NO2 — CID 110669345
benzyl N-(2,2-dimethylpropyl)-N-methylcarbamate (PubChem CID 110669345) has the molecular formula C14H21NO2 and a molecular weight of 235.33 g/mol. Its IUPAC name is benzyl N-(2,2-dimethylpropyl)-N-methylcarbamate.
| Compound Name | benzyl N-(2,2-dimethylpropyl)-N-methylcarbamate |
|---|---|
| PubChem CID | 110669345 |
| Molecular Formula | C14H21NO2 |
| Molecular Weight | 235.33 g/mol |
| Exact Mass | 235.16 |
| IUPAC Name | benzyl N-(2,2-dimethylpropyl)-N-methylcarbamate |
| SMILES | CN(CC(C)(C)C)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C14H21NO2/c1-14(2,3)11-15(4)13(16)17-10-12-8-6-5-7-9-12/h5-9H,10-11H2,1-4H3 |
| InChIKey | OPINPWHGRFEVRE-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.33 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |