C19H24N2O4 — CID 175696861
benzyl(phenylmethoxycarbonyl)carbamic acid;N,N-dimethylmethanamine (PubChem CID 175696861) has the molecular formula C19H24N2O4 and a molecular weight of 344.41 g/mol. Its IUPAC name is benzyl(phenylmethoxycarbonyl)carbamic acid;N,N-dimethylmethanamine.
| Compound Name | benzyl(phenylmethoxycarbonyl)carbamic acid;N,N-dimethylmethanamine |
|---|---|
| PubChem CID | 175696861 |
| Molecular Formula | C19H24N2O4 |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.17 |
| IUPAC Name | benzyl(phenylmethoxycarbonyl)carbamic acid;N,N-dimethylmethanamine |
| SMILES | CN(C)C.O=C(O)N(Cc1ccccc1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C16H15NO4.C3H9N/c18-15(19)17(11-13-7-3-1-4-8-13)16(20)21-12-14-9-5-2-6-10-14;1-4(2)3/h1-10H,11-12H2,(H,18,19);1-3H3 |
| InChIKey | NZUOOLJVFWIGMC-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |