About Benzyl dimethylcarbamate
Benzyl dimethylcarbamate (PubChem CID 12963450) has the molecular formula C10H13NO2
and a molecular weight of 179.22 g/mol. Its IUPAC name is benzyl N,N-dimethylcarbamate.
Molecular Properties
| Compound Name | Benzyl dimethylcarbamate |
| PubChem CID | 12963450 |
| Molecular Formula | C10H13NO2 |
| Molecular Weight | 179.22 g/mol |
| Exact Mass | 179.09 |
| IUPAC Name | benzyl N,N-dimethylcarbamate |
| SMILES | CN(C)C(=O)OCC1=CC=CC=C1 |
| InChI | InChI=1S/C10H13NO2/c1-11(2)10(12)13-8-9-6-4-3-5-7-9/h3-7H,8H2,1-2H3 |
| InChIKey | RSQKOKVVSFQCQZ-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 29.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | 162 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.22 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze Benzyl dimethylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Benzyl dimethylcarbamate?
The IUPAC name of Benzyl dimethylcarbamate (CID 12963450) is benzyl N,N-dimethylcarbamate.
What is the SMILES notation for Benzyl dimethylcarbamate?
The canonical SMILES for Benzyl dimethylcarbamate is CN(C)C(=O)OCC1=CC=CC=C1.
What is the InChIKey of Benzyl dimethylcarbamate?
The InChIKey is RSQKOKVVSFQCQZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13NO2/c1-11(2)10(12)13-8-9-6-4-3-5-7-9/h3-7H,8H2,1-2H3.
What are the key properties of Benzyl dimethylcarbamate?
Benzyl dimethylcarbamate has a molecular weight of 179.22 g/mol, XLogP of 2.20, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for Benzyl dimethylcarbamate is sourced from PubChem (CID 12963450), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).