C15H20Br2O — CID 171079837
7-bromo-7-(3-bromophenyl)-2,2-dimethylheptanal (PubChem CID 171079837) has the molecular formula C15H20Br2O and a molecular weight of 376.13 g/mol. Its IUPAC name is 7-bromo-7-(3-bromophenyl)-2,2-dimethylheptanal.
| Compound Name | 7-bromo-7-(3-bromophenyl)-2,2-dimethylheptanal |
|---|---|
| PubChem CID | 171079837 |
| Molecular Formula | C15H20Br2O |
| Molecular Weight | 376.13 g/mol |
| Exact Mass | 373.99 |
| IUPAC Name | 7-bromo-7-(3-bromophenyl)-2,2-dimethylheptanal |
| SMILES | CC(C)(C=O)CCCCC(Br)c1cccc(Br)c1 |
| InChI | InChI=1S/C15H20Br2O/c1-15(2,11-18)9-4-3-8-14(17)12-6-5-7-13(16)10-12/h5-7,10-11,14H,3-4,8-9H2,1-2H3 |
| InChIKey | AHZBYQCAYYGGTH-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.13 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|