C14H18Br2O2 — CID 171078914
3-[3-bromo-3-(3-bromophenyl)propoxy]-2,2-dimethylpropanal (PubChem CID 171078914) has the molecular formula C14H18Br2O2 and a molecular weight of 378.10 g/mol. Its IUPAC name is 3-[3-bromo-3-(3-bromophenyl)propoxy]-2,2-dimethylpropanal.
| Compound Name | 3-[3-bromo-3-(3-bromophenyl)propoxy]-2,2-dimethylpropanal |
|---|---|
| PubChem CID | 171078914 |
| Molecular Formula | C14H18Br2O2 |
| Molecular Weight | 378.10 g/mol |
| Exact Mass | 375.97 |
| IUPAC Name | 3-[3-bromo-3-(3-bromophenyl)propoxy]-2,2-dimethylpropanal |
| SMILES | CC(C)(C=O)COCCC(Br)c1cccc(Br)c1 |
| InChI | InChI=1S/C14H18Br2O2/c1-14(2,9-17)10-18-7-6-13(16)11-4-3-5-12(15)8-11/h3-5,8-9,13H,6-7,10H2,1-2H3 |
| InChIKey | TUUQZXSUSUXBRE-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.10 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|