About 2-(3-bromophenyl)butanal
2-(3-bromophenyl)butanal (PubChem CID 83839920) has the molecular formula C10H11BrO
and a molecular weight of 227.10 g/mol. Its IUPAC name is 2-(3-bromophenyl)butanal.
Molecular Properties
| Compound Name | 2-(3-bromophenyl)butanal |
| PubChem CID | 83839920 |
| Molecular Formula | C10H11BrO |
| Molecular Weight | 227.10 g/mol |
| Exact Mass | 226.00 |
| IUPAC Name | 2-(3-bromophenyl)butanal |
| SMILES | CCC(C=O)c1cccc(Br)c1 |
| InChI | InChI=1S/C10H11BrO/c1-2-8(7-12)9-4-3-5-10(11)6-9/h3-8H,2H2,1H3 |
| InChIKey | UKYWDQPCQWBIOT-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.10 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-(3-bromophenyl)butanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-bromophenyl)butanal?
The IUPAC name of 2-(3-bromophenyl)butanal (CID 83839920) is 2-(3-bromophenyl)butanal.
What is the SMILES notation for 2-(3-bromophenyl)butanal?
The canonical SMILES for 2-(3-bromophenyl)butanal is CCC(C=O)c1cccc(Br)c1.
What is the InChIKey of 2-(3-bromophenyl)butanal?
The InChIKey is UKYWDQPCQWBIOT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11BrO/c1-2-8(7-12)9-4-3-5-10(11)6-9/h3-8H,2H2,1H3.
What are the key properties of 2-(3-bromophenyl)butanal?
2-(3-bromophenyl)butanal has a molecular weight of 227.10 g/mol, XLogP of 3.14, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-bromophenyl)butanal is sourced from PubChem (CID 83839920), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).