C13H14Br2 — CID 88966479
1-bromo-3-[(5E)-5-bromohepta-1,5-dien-3-yl]benzene (PubChem CID 88966479) has the molecular formula C13H14Br2 and a molecular weight of 330.06 g/mol. Its IUPAC name is 1-bromo-3-[(5E)-5-bromohepta-1,5-dien-3-yl]benzene.
| Compound Name | 1-bromo-3-[(5E)-5-bromohepta-1,5-dien-3-yl]benzene |
|---|---|
| PubChem CID | 88966479 |
| Molecular Formula | C13H14Br2 |
| Molecular Weight | 330.06 g/mol |
| Exact Mass | 327.95 |
| IUPAC Name | 1-bromo-3-[(5E)-5-bromohepta-1,5-dien-3-yl]benzene |
| SMILES | C=CC(C/C(Br)=C\C)c1cccc(Br)c1 |
| InChI | InChI=1S/C13H14Br2/c1-3-10(8-12(14)4-2)11-6-5-7-13(15)9-11/h3-7,9-10H,1,8H2,2H3/b12-4+ |
| InChIKey | XBKAZCYQIIQASS-UUILKARUSA-N |
| XLogP | 5.41 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.06 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|