C13H20BrN — CID 79443196
2-(3-bromophenyl)-N-propylbutan-1-amine (PubChem CID 79443196) has the molecular formula C13H20BrN and a molecular weight of 270.21 g/mol. Its IUPAC name is 2-(3-bromophenyl)-N-propylbutan-1-amine.
| Compound Name | 2-(3-bromophenyl)-N-propylbutan-1-amine |
|---|---|
| PubChem CID | 79443196 |
| Molecular Formula | C13H20BrN |
| Molecular Weight | 270.21 g/mol |
| Exact Mass | 269.08 |
| IUPAC Name | 2-(3-bromophenyl)-N-propylbutan-1-amine |
| SMILES | CCCNCC(CC)c1cccc(Br)c1 |
| InChI | InChI=1S/C13H20BrN/c1-3-8-15-10-11(4-2)12-6-5-7-13(14)9-12/h5-7,9,11,15H,3-4,8,10H2,1-2H3 |
| InChIKey | ZVXZEKGPZVEDEN-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.21 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|