C15H26BrNSi — CID 106323813
2-(3-bromophenyl)-N-propyl-3-trimethylsilylpropan-1-amine (PubChem CID 106323813) has the molecular formula C15H26BrNSi and a molecular weight of 328.37 g/mol. Its IUPAC name is 2-(3-bromophenyl)-N-propyl-3-trimethylsilylpropan-1-amine.
| Compound Name | 2-(3-bromophenyl)-N-propyl-3-trimethylsilylpropan-1-amine |
|---|---|
| PubChem CID | 106323813 |
| Molecular Formula | C15H26BrNSi |
| Molecular Weight | 328.37 g/mol |
| Exact Mass | 327.10 |
| IUPAC Name | 2-(3-bromophenyl)-N-propyl-3-trimethylsilylpropan-1-amine |
| SMILES | CCCNCC(C[Si](C)(C)C)c1cccc(Br)c1 |
| InChI | InChI=1S/C15H26BrNSi/c1-5-9-17-11-14(12-18(2,3)4)13-7-6-8-15(16)10-13/h6-8,10,14,17H,5,9,11-12H2,1-4H3 |
| InChIKey | ZENOJJVAWUWYKE-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.37 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|