C15H22Br2O — CID 171079501
7-bromo-7-(3-bromophenyl)-2,2-dimethylheptan-1-ol (PubChem CID 171079501) has the molecular formula C15H22Br2O and a molecular weight of 378.15 g/mol. Its IUPAC name is 7-bromo-7-(3-bromophenyl)-2,2-dimethylheptan-1-ol.
| Compound Name | 7-bromo-7-(3-bromophenyl)-2,2-dimethylheptan-1-ol |
|---|---|
| PubChem CID | 171079501 |
| Molecular Formula | C15H22Br2O |
| Molecular Weight | 378.15 g/mol |
| Exact Mass | 376.00 |
| IUPAC Name | 7-bromo-7-(3-bromophenyl)-2,2-dimethylheptan-1-ol |
| SMILES | CC(C)(CO)CCCCC(Br)c1cccc(Br)c1 |
| InChI | InChI=1S/C15H22Br2O/c1-15(2,11-18)9-4-3-8-14(17)12-6-5-7-13(16)10-12/h5-7,10,14,18H,3-4,8-9,11H2,1-2H3 |
| InChIKey | DXJICXKBSGSXHF-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.15 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|