C19H29BrO3 — CID 171077010
6-(3-bromophenyl)-2,2-dimethyl-6-(oxan-2-yloxy)hexan-1-ol (PubChem CID 171077010) has the molecular formula C19H29BrO3 and a molecular weight of 385.34 g/mol. Its IUPAC name is 6-(3-bromophenyl)-2,2-dimethyl-6-(oxan-2-yloxy)hexan-1-ol.
| Compound Name | 6-(3-bromophenyl)-2,2-dimethyl-6-(oxan-2-yloxy)hexan-1-ol |
|---|---|
| PubChem CID | 171077010 |
| Molecular Formula | C19H29BrO3 |
| Molecular Weight | 385.34 g/mol |
| Exact Mass | 384.13 |
| IUPAC Name | 6-(3-bromophenyl)-2,2-dimethyl-6-(oxan-2-yloxy)hexan-1-ol |
| SMILES | CC(C)(CO)CCCC(OC1CCCCO1)c1cccc(Br)c1 |
| InChI | InChI=1S/C19H29BrO3/c1-19(2,14-21)11-6-9-17(15-7-5-8-16(20)13-15)23-18-10-3-4-12-22-18/h5,7-8,13,17-18,21H,3-4,6,9-12,14H2,1-2H3 |
| InChIKey | ZJJNACQNVWNMIQ-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.34 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |