C24H36O5 — CID 171077180
ethyl 3-[3-[6-hydroxy-5,5-dimethyl-1-(oxan-2-yloxy)hexyl]phenyl]prop-2-enoate (PubChem CID 171077180) has the molecular formula C24H36O5 and a molecular weight of 404.55 g/mol. Its IUPAC name is ethyl 3-[3-[6-hydroxy-5,5-dimethyl-1-(oxan-2-yloxy)hexyl]phenyl]prop-2-enoate.
| Compound Name | ethyl 3-[3-[6-hydroxy-5,5-dimethyl-1-(oxan-2-yloxy)hexyl]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 171077180 |
| Molecular Formula | C24H36O5 |
| Molecular Weight | 404.55 g/mol |
| Exact Mass | 404.26 |
| IUPAC Name | ethyl 3-[3-[6-hydroxy-5,5-dimethyl-1-(oxan-2-yloxy)hexyl]phenyl]prop-2-enoate |
| SMILES | CCOC(=O)C=Cc1cccc(C(CCCC(C)(C)CO)OC2CCCCO2)c1 |
| InChI | InChI=1S/C24H36O5/c1-4-27-22(26)14-13-19-9-7-10-20(17-19)21(11-8-15-24(2,3)18-25)29-23-12-5-6-16-28-23/h7,9-10,13-14,17,21,23,25H,4-6,8,11-12,15-16,18H2,1-3H3 |
| InChIKey | QYXCQWASEKFZSO-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.55 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|