C38H42O9 — CID 11534711
[4-[(E)-3-[(2R)-2-(oxan-2-yloxy)-2-phenylethoxy]-3-oxoprop-1-enyl]phenyl] 4-(6-prop-2-enoyloxyhexoxy)benzoate (PubChem CID 11534711) has the molecular formula C38H42O9 and a molecular weight of 642.75 g/mol. Its IUPAC name is [4-[(E)-3-[(2R)-2-(oxan-2-yloxy)-2-phenylethoxy]-3-oxoprop-1-enyl]phenyl] 4-(6-prop-2-enoyloxyhexoxy)benzoate.
| Compound Name | [4-[(E)-3-[(2R)-2-(oxan-2-yloxy)-2-phenylethoxy]-3-oxoprop-1-enyl]phenyl] 4-(6-prop-2-enoyloxyhexoxy)benzoate |
|---|---|
| PubChem CID | 11534711 |
| Molecular Formula | C38H42O9 |
| Molecular Weight | 642.75 g/mol |
| Exact Mass | 642.28 |
| IUPAC Name | [4-[(E)-3-[(2R)-2-(oxan-2-yloxy)-2-phenylethoxy]-3-oxoprop-1-enyl]phenyl] 4-(6-prop-2-enoyloxyhexoxy)benzoate |
| SMILES | C=CC(=O)OCCCCCCOc1ccc(C(=O)Oc2ccc(/C=C/C(=O)OC[C@H](OC3CCCCO3)c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C38H42O9/c1-2-35(39)43-26-10-4-3-9-25-42-32-22-18-31(19-23-32)38(41)46-33-20-15-29(16-21-33)17-24-36(40)45-28-34(30-12-6-5-7-13-30)47-37-14-8-11-27-44-37/h2,5-7,12-13,15-24,34,37H,1,3-4,8-11,14,25-28H2/b24-17+/t34-,37?/m0/s1 |
| InChIKey | CCRZLWJIBNUATF-IXSJTGOYSA-N |
| XLogP | 7.42 |
| TPSA | 106.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.75 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|