C25H26O7 — CID 11568339
(E)-3-[4-[4-(6-prop-2-enoyloxyhexoxy)benzoyl]oxyphenyl]prop-2-enoic acid (PubChem CID 11568339) has the molecular formula C25H26O7 and a molecular weight of 438.48 g/mol. Its IUPAC name is (E)-3-[4-[4-(6-prop-2-enoyloxyhexoxy)benzoyl]oxyphenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-[4-(6-prop-2-enoyloxyhexoxy)benzoyl]oxyphenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 11568339 |
| Molecular Formula | C25H26O7 |
| Molecular Weight | 438.48 g/mol |
| Exact Mass | 438.17 |
| IUPAC Name | (E)-3-[4-[4-(6-prop-2-enoyloxyhexoxy)benzoyl]oxyphenyl]prop-2-enoic acid |
| SMILES | C=CC(=O)OCCCCCCOc1ccc(C(=O)Oc2ccc(/C=C/C(=O)O)cc2)cc1 |
| InChI | InChI=1S/C25H26O7/c1-2-24(28)31-18-6-4-3-5-17-30-21-14-10-20(11-15-21)25(29)32-22-12-7-19(8-13-22)9-16-23(26)27/h2,7-16H,1,3-6,17-18H2,(H,26,27)/b16-9+ |
| InChIKey | AUQJBIDXQJWTOH-CXUHLZMHSA-N |
| XLogP | 4.67 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.48 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|