C38H42O9 — CID 118528788
[4-[4-(7-oxonon-8-enoxy)phenoxy]carbonylphenyl] 4-(6-prop-2-enoyloxyhexoxy)benzoate (PubChem CID 118528788) has the molecular formula C38H42O9 and a molecular weight of 642.75 g/mol. Its IUPAC name is [4-[4-(7-oxonon-8-enoxy)phenoxy]carbonylphenyl] 4-(6-prop-2-enoyloxyhexoxy)benzoate.
| Compound Name | [4-[4-(7-oxonon-8-enoxy)phenoxy]carbonylphenyl] 4-(6-prop-2-enoyloxyhexoxy)benzoate |
|---|---|
| PubChem CID | 118528788 |
| Molecular Formula | C38H42O9 |
| Molecular Weight | 642.75 g/mol |
| Exact Mass | 642.28 |
| IUPAC Name | [4-[4-(7-oxonon-8-enoxy)phenoxy]carbonylphenyl] 4-(6-prop-2-enoyloxyhexoxy)benzoate |
| SMILES | C=CC(=O)CCCCCCOc1ccc(OC(=O)c2ccc(OC(=O)c3ccc(OCCCCCCOC(=O)C=C)cc3)cc2)cc1 |
| InChI | InChI=1S/C38H42O9/c1-3-31(39)13-9-5-6-10-26-44-33-22-24-35(25-23-33)47-38(42)30-16-20-34(21-17-30)46-37(41)29-14-18-32(19-15-29)43-27-11-7-8-12-28-45-36(40)4-2/h3-4,14-25H,1-2,5-13,26-28H2 |
| InChIKey | QNWOMAKNFUNITH-UHFFFAOYSA-N |
| XLogP | 7.88 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.75 |
| LogP ≤ 5 | 7.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|