C39H36O10 — CID 118547337
[4-[4-(3-prop-2-enoyloxypropoxy)benzoyl]oxyphenyl] 4-[4-(4-prop-2-enoyloxybutoxy)phenyl]benzoate (PubChem CID 118547337) has the molecular formula C39H36O10 and a molecular weight of 664.71 g/mol. Its IUPAC name is [4-[4-(3-prop-2-enoyloxypropoxy)benzoyl]oxyphenyl] 4-[4-(4-prop-2-enoyloxybutoxy)phenyl]benzoate.
| Compound Name | [4-[4-(3-prop-2-enoyloxypropoxy)benzoyl]oxyphenyl] 4-[4-(4-prop-2-enoyloxybutoxy)phenyl]benzoate |
|---|---|
| PubChem CID | 118547337 |
| Molecular Formula | C39H36O10 |
| Molecular Weight | 664.71 g/mol |
| Exact Mass | 664.23 |
| IUPAC Name | [4-[4-(3-prop-2-enoyloxypropoxy)benzoyl]oxyphenyl] 4-[4-(4-prop-2-enoyloxybutoxy)phenyl]benzoate |
| SMILES | C=CC(=O)OCCCCOc1ccc(-c2ccc(C(=O)Oc3ccc(OC(=O)c4ccc(OCCCOC(=O)C=C)cc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C39H36O10/c1-3-36(40)46-25-6-5-24-44-32-16-12-29(13-17-32)28-8-10-30(11-9-28)38(42)48-34-20-22-35(23-21-34)49-39(43)31-14-18-33(19-15-31)45-26-7-27-47-37(41)4-2/h3-4,8-23H,1-2,5-7,24-27H2 |
| InChIKey | VTXMBYNINSHPCJ-UHFFFAOYSA-N |
| XLogP | 7.18 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.71 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|