C27H26O6 — CID 59668546
[4-(4-methoxyphenyl)phenyl] 4-(4-prop-2-enoyloxybutoxy)benzoate (PubChem CID 59668546) has the molecular formula C27H26O6 and a molecular weight of 446.50 g/mol. Its IUPAC name is [4-(4-methoxyphenyl)phenyl] 4-(4-prop-2-enoyloxybutoxy)benzoate.
| Compound Name | [4-(4-methoxyphenyl)phenyl] 4-(4-prop-2-enoyloxybutoxy)benzoate |
|---|---|
| PubChem CID | 59668546 |
| Molecular Formula | C27H26O6 |
| Molecular Weight | 446.50 g/mol |
| Exact Mass | 446.17 |
| IUPAC Name | [4-(4-methoxyphenyl)phenyl] 4-(4-prop-2-enoyloxybutoxy)benzoate |
| SMILES | C=CC(=O)OCCCCOc1ccc(C(=O)Oc2ccc(-c3ccc(OC)cc3)cc2)cc1 |
| InChI | InChI=1S/C27H26O6/c1-3-26(28)32-19-5-4-18-31-24-14-10-22(11-15-24)27(29)33-25-16-8-21(9-17-25)20-6-12-23(30-2)13-7-20/h3,6-17H,1,4-5,18-19H2,2H3 |
| InChIKey | KIHQGTRGONOTHR-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.50 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|