C36H40O10 — CID 158691914
(4-methylphenyl) 4-(4-prop-2-enoyloxybutoxy)benzoate;methyl 4-(4-prop-2-enoyloxybutoxy)benzoate (PubChem CID 158691914) has the molecular formula C36H40O10 and a molecular weight of 632.71 g/mol. Its IUPAC name is (4-methylphenyl) 4-(4-prop-2-enoyloxybutoxy)benzoate;methyl 4-(4-prop-2-enoyloxybutoxy)benzoate.
| Compound Name | (4-methylphenyl) 4-(4-prop-2-enoyloxybutoxy)benzoate;methyl 4-(4-prop-2-enoyloxybutoxy)benzoate |
|---|---|
| PubChem CID | 158691914 |
| Molecular Formula | C36H40O10 |
| Molecular Weight | 632.71 g/mol |
| Exact Mass | 632.26 |
| IUPAC Name | (4-methylphenyl) 4-(4-prop-2-enoyloxybutoxy)benzoate;methyl 4-(4-prop-2-enoyloxybutoxy)benzoate |
| SMILES | C=CC(=O)OCCCCOc1ccc(C(=O)OC)cc1.C=CC(=O)OCCCCOc1ccc(C(=O)Oc2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C21H22O5.C15H18O5/c1-3-20(22)25-15-5-4-14-24-18-12-8-17(9-13-18)21(23)26-19-10-6-16(2)7-11-19;1-3-14(16)20-11-5-4-10-19-13-8-6-12(7-9-13)15(17)18-2/h3,6-13H,1,4-5,14-15H2,2H3;3,6-9H,1,4-5,10-11H2,2H3 |
| InChIKey | IGLMSXUSOYHDLS-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.71 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|