C38H43FO10 — CID 160994368
(2-fluoro-4-methylphenyl) 4-(5-prop-2-enoyloxypentoxy)benzoate;methyl 4-(5-prop-2-enoyloxypentoxy)benzoate (PubChem CID 160994368) has the molecular formula C38H43FO10 and a molecular weight of 678.75 g/mol. Its IUPAC name is (2-fluoro-4-methylphenyl) 4-(5-prop-2-enoyloxypentoxy)benzoate;methyl 4-(5-prop-2-enoyloxypentoxy)benzoate.
| Compound Name | (2-fluoro-4-methylphenyl) 4-(5-prop-2-enoyloxypentoxy)benzoate;methyl 4-(5-prop-2-enoyloxypentoxy)benzoate |
|---|---|
| PubChem CID | 160994368 |
| Molecular Formula | C38H43FO10 |
| Molecular Weight | 678.75 g/mol |
| Exact Mass | 678.28 |
| IUPAC Name | (2-fluoro-4-methylphenyl) 4-(5-prop-2-enoyloxypentoxy)benzoate;methyl 4-(5-prop-2-enoyloxypentoxy)benzoate |
| SMILES | C=CC(=O)OCCCCCOc1ccc(C(=O)OC)cc1.C=CC(=O)OCCCCCOc1ccc(C(=O)Oc2ccc(C)cc2F)cc1 |
| InChI | InChI=1S/C22H23FO5.C16H20O5/c1-3-21(24)27-14-6-4-5-13-26-18-10-8-17(9-11-18)22(25)28-20-12-7-16(2)15-19(20)23;1-3-15(17)21-12-6-4-5-11-20-14-9-7-13(8-10-14)16(18)19-2/h3,7-12,15H,1,4-6,13-14H2,2H3;3,7-10H,1,4-6,11-12H2,2H3 |
| InChIKey | TVAYZUIGQGLGER-UHFFFAOYSA-N |
| XLogP | 7.38 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.75 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|