C46H56F2O10 — CID 158987086
[2,3-difluoro-4-[4-(10-prop-2-enoyloxydecoxy)benzoyl]oxyphenyl] 4-(10-prop-2-enoyloxydecoxy)benzoate (PubChem CID 158987086) has the molecular formula C46H56F2O10 and a molecular weight of 806.94 g/mol. Its IUPAC name is [2,3-difluoro-4-[4-(10-prop-2-enoyloxydecoxy)benzoyl]oxyphenyl] 4-(10-prop-2-enoyloxydecoxy)benzoate.
| Compound Name | [2,3-difluoro-4-[4-(10-prop-2-enoyloxydecoxy)benzoyl]oxyphenyl] 4-(10-prop-2-enoyloxydecoxy)benzoate |
|---|---|
| PubChem CID | 158987086 |
| Molecular Formula | C46H56F2O10 |
| Molecular Weight | 806.94 g/mol |
| Exact Mass | 806.38 |
| IUPAC Name | [2,3-difluoro-4-[4-(10-prop-2-enoyloxydecoxy)benzoyl]oxyphenyl] 4-(10-prop-2-enoyloxydecoxy)benzoate |
| SMILES | C=CC(=O)OCCCCCCCCCCOc1ccc(C(=O)Oc2ccc(OC(=O)c3ccc(OCCCCCCCCCCOC(=O)C=C)cc3)c(F)c2F)cc1 |
| InChI | InChI=1S/C46H56F2O10/c1-3-41(49)55-33-19-15-11-7-5-9-13-17-31-53-37-25-21-35(22-26-37)45(51)57-39-29-30-40(44(48)43(39)47)58-46(52)36-23-27-38(28-24-36)54-32-18-14-10-6-8-12-16-20-34-56-42(50)4-2/h3-4,21-30H,1-2,5-20,31-34H2 |
| InChIKey | RGQZFZVHPWEUPR-UHFFFAOYSA-N |
| XLogP | 10.86 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 806.94 |
| LogP ≤ 5 | 10.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|