C34H33FO10 — CID 89154465
[3-fluoro-4-[4-(4-prop-2-enoyloxybutoxy)benzoyl]oxyphenyl] 4-(4-prop-2-enoyloxybutoxy)benzoate (PubChem CID 89154465) has the molecular formula C34H33FO10 and a molecular weight of 620.63 g/mol. Its IUPAC name is [3-fluoro-4-[4-(4-prop-2-enoyloxybutoxy)benzoyl]oxyphenyl] 4-(4-prop-2-enoyloxybutoxy)benzoate.
| Compound Name | [3-fluoro-4-[4-(4-prop-2-enoyloxybutoxy)benzoyl]oxyphenyl] 4-(4-prop-2-enoyloxybutoxy)benzoate |
|---|---|
| PubChem CID | 89154465 |
| Molecular Formula | C34H33FO10 |
| Molecular Weight | 620.63 g/mol |
| Exact Mass | 620.21 |
| IUPAC Name | [3-fluoro-4-[4-(4-prop-2-enoyloxybutoxy)benzoyl]oxyphenyl] 4-(4-prop-2-enoyloxybutoxy)benzoate |
| SMILES | C=CC(=O)OCCCCOc1ccc(C(=O)Oc2ccc(OC(=O)c3ccc(OCCCCOC(=O)C=C)cc3)c(F)c2)cc1 |
| InChI | InChI=1S/C34H33FO10/c1-3-31(36)42-21-7-5-19-40-26-13-9-24(10-14-26)33(38)44-28-17-18-30(29(35)23-28)45-34(39)25-11-15-27(16-12-25)41-20-6-8-22-43-32(37)4-2/h3-4,9-18,23H,1-2,5-8,19-22H2 |
| InChIKey | YAIOFRLSWGQODO-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.63 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|