C44H52F2O10 — CID 159974133
[2,5-difluoro-4-[4-(9-prop-2-enoyloxynonoxy)benzoyl]oxyphenyl] 4-(9-prop-2-enoyloxynonoxy)benzoate (PubChem CID 159974133) has the molecular formula C44H52F2O10 and a molecular weight of 778.89 g/mol. Its IUPAC name is [2,5-difluoro-4-[4-(9-prop-2-enoyloxynonoxy)benzoyl]oxyphenyl] 4-(9-prop-2-enoyloxynonoxy)benzoate.
| Compound Name | [2,5-difluoro-4-[4-(9-prop-2-enoyloxynonoxy)benzoyl]oxyphenyl] 4-(9-prop-2-enoyloxynonoxy)benzoate |
|---|---|
| PubChem CID | 159974133 |
| Molecular Formula | C44H52F2O10 |
| Molecular Weight | 778.89 g/mol |
| Exact Mass | 778.35 |
| IUPAC Name | [2,5-difluoro-4-[4-(9-prop-2-enoyloxynonoxy)benzoyl]oxyphenyl] 4-(9-prop-2-enoyloxynonoxy)benzoate |
| SMILES | C=CC(=O)OCCCCCCCCCOc1ccc(C(=O)Oc2cc(F)c(OC(=O)c3ccc(OCCCCCCCCCOC(=O)C=C)cc3)cc2F)cc1 |
| InChI | InChI=1S/C44H52F2O10/c1-3-41(47)53-29-17-13-9-5-7-11-15-27-51-35-23-19-33(20-24-35)43(49)55-39-31-38(46)40(32-37(39)45)56-44(50)34-21-25-36(26-22-34)52-28-16-12-8-6-10-14-18-30-54-42(48)4-2/h3-4,19-26,31-32H,1-2,5-18,27-30H2 |
| InChIKey | SQHBQFFOLPVPOG-UHFFFAOYSA-N |
| XLogP | 10.08 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 778.89 |
| LogP ≤ 5 | 10.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|