C36H35F3O10 — CID 161125373
[2,3,5-trifluoro-4-[4-(5-prop-2-enoyloxypentoxy)benzoyl]oxyphenyl] 4-(5-prop-2-enoyloxypentoxy)benzoate (PubChem CID 161125373) has the molecular formula C36H35F3O10 and a molecular weight of 684.66 g/mol. Its IUPAC name is [2,3,5-trifluoro-4-[4-(5-prop-2-enoyloxypentoxy)benzoyl]oxyphenyl] 4-(5-prop-2-enoyloxypentoxy)benzoate.
| Compound Name | [2,3,5-trifluoro-4-[4-(5-prop-2-enoyloxypentoxy)benzoyl]oxyphenyl] 4-(5-prop-2-enoyloxypentoxy)benzoate |
|---|---|
| PubChem CID | 161125373 |
| Molecular Formula | C36H35F3O10 |
| Molecular Weight | 684.66 g/mol |
| Exact Mass | 684.22 |
| IUPAC Name | [2,3,5-trifluoro-4-[4-(5-prop-2-enoyloxypentoxy)benzoyl]oxyphenyl] 4-(5-prop-2-enoyloxypentoxy)benzoate |
| SMILES | C=CC(=O)OCCCCCOc1ccc(C(=O)Oc2cc(F)c(OC(=O)c3ccc(OCCCCCOC(=O)C=C)cc3)c(F)c2F)cc1 |
| InChI | InChI=1S/C36H35F3O10/c1-3-30(40)46-21-9-5-7-19-44-26-15-11-24(12-16-26)35(42)48-29-23-28(37)34(33(39)32(29)38)49-36(43)25-13-17-27(18-14-25)45-20-8-6-10-22-47-31(41)4-2/h3-4,11-18,23H,1-2,5-10,19-22H2 |
| InChIKey | WEWKADXBLJRIRG-UHFFFAOYSA-N |
| XLogP | 7.10 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.66 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|